C7H11NO5 — CID 91142406
4-hydroxy-3-methylpyrrolidine-1,3-dicarboxylic acid (PubChem CID 91142406) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-hydroxy-3-methylpyrrolidine-1,3-dicarboxylic acid.
| Compound Name | 4-hydroxy-3-methylpyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91142406 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 4-hydroxy-3-methylpyrrolidine-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CN(C(=O)O)CC1O |
| InChI | InChI=1S/C7H11NO5/c1-7(5(10)11)3-8(6(12)13)2-4(7)9/h4,9H,2-3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | YORJGGONEFSPKL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |