C19H34N4O8 — CID 91142434
3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanehydrazide (PubChem CID 91142434) has the molecular formula C19H34N4O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanehydrazide.
| Compound Name | 3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanehydrazide |
|---|---|
| PubChem CID | 91142434 |
| Molecular Formula | C19H34N4O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanehydrazide |
| SMILES | NNC(=O)CCOCCOCCOCCOCCNCC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C19H34N4O8/c20-22-17(25)4-7-28-9-11-30-13-14-31-12-10-29-8-5-21-15-16(24)3-6-23-18(26)1-2-19(23)27/h1-2,21,26-27H,3-15,20H2,(H,22,25) |
| InChIKey | XFPIQALGUDUILH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|