C23H40N4O10 — CID 91457911
tert-butyl N-[3-[2-[2-[2-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate (PubChem CID 91457911) has the molecular formula C23H40N4O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[2-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[2-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
|---|---|
| PubChem CID | 91457911 |
| Molecular Formula | C23H40N4O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[2-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCOCCOCCOCCOCCNC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C23H40N4O10/c1-23(2,3)37-22(32)26-25-19(29)7-10-33-12-14-35-16-17-36-15-13-34-11-8-24-18(28)6-9-27-20(30)4-5-21(27)31/h4-5,30-31H,6-17H2,1-3H3,(H,24,28)(H,25,29)(H,26,32) |
| InChIKey | MJGSCYMJGCDLJJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 178.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|