C24H42N4O10 — CID 91616148
tert-butyl N-[3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate (PubChem CID 91616148) has the molecular formula C24H42N4O10 and a molecular weight of 546.62 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
|---|---|
| PubChem CID | 91616148 |
| Molecular Formula | C24H42N4O10 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[2-[2-[[4-(2,5-dihydroxypyrrol-1-yl)-2-oxobutyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCOCCOCCOCCOCCNCC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C24H42N4O10/c1-24(2,3)38-23(33)27-26-20(30)7-10-34-12-14-36-16-17-37-15-13-35-11-8-25-18-19(29)6-9-28-21(31)4-5-22(28)32/h4-5,25,31-32H,6-18H2,1-3H3,(H,26,30)(H,27,33) |
| InChIKey | IYHBKHCZLOSUSO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 178.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|