C18H27BrN2O3 — CID 91143680
(1-amino-3-methyl-2-propan-2-ylbutyl) 4-amino-2-(4-bromophenyl)-4-oxobutanoate (PubChem CID 91143680) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is (1-amino-3-methyl-2-propan-2-ylbutyl) 4-amino-2-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | (1-amino-3-methyl-2-propan-2-ylbutyl) 4-amino-2-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 91143680 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (1-amino-3-methyl-2-propan-2-ylbutyl) 4-amino-2-(4-bromophenyl)-4-oxobutanoate |
| SMILES | CC(C)C(C(C)C)C(N)OC(=O)C(CC(N)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H27BrN2O3/c1-10(2)16(11(3)4)17(21)24-18(23)14(9-15(20)22)12-5-7-13(19)8-6-12/h5-8,10-11,14,16-17H,9,21H2,1-4H3,(H2,20,22) |
| InChIKey | GETJFNNPCAWWST-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|