C13H19N3O2S — CID 91144202
N-(4-hydroxy-5,5-dimethyl-1-sulfanylpiperidin-3-yl)pyridine-2-carboxamide (PubChem CID 91144202) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(4-hydroxy-5,5-dimethyl-1-sulfanylpiperidin-3-yl)pyridine-2-carboxamide.
| Compound Name | N-(4-hydroxy-5,5-dimethyl-1-sulfanylpiperidin-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91144202 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(4-hydroxy-5,5-dimethyl-1-sulfanylpiperidin-3-yl)pyridine-2-carboxamide |
| SMILES | CC1(C)CN(S)CC(NC(=O)c2ccccn2)C1O |
| InChI | InChI=1S/C13H19N3O2S/c1-13(2)8-16(19)7-10(11(13)17)15-12(18)9-5-3-4-6-14-9/h3-6,10-11,17,19H,7-8H2,1-2H3,(H,15,18) |
| InChIKey | HIDPOMDJGIZRSB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|