C13H16NO6P+2 — CID 91145066
[(3R)-3-(cyclohexatrienylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxy-oxophosphanium (PubChem CID 91145066) has the molecular formula C13H16NO6P+2 and a molecular weight of 313.25 g/mol. Its IUPAC name is [(3R)-3-(cyclohexatrienylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-3-(cyclohexatrienylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 91145066 |
| Molecular Formula | C13H16NO6P+2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [(3R)-3-(cyclohexatrienylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxy-oxophosphanium |
| SMILES | COC(=O)[C@@H](CC[P+](=O)O)NC(=O)OCC1=CC=[C+]C=C1 |
| InChI | InChI=1S/C13H14NO6P/c1-19-12(15)11(7-8-21(17)18)14-13(16)20-9-10-5-3-2-4-6-10/h3-6,11H,7-9H2,1H3/p+2/t11-/m1/s1 |
| InChIKey | FMVJQVQSNKRFGO-LLVKDONJSA-P |
| XLogP | 1.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|