C13H13Cl3NO4- — CID 9114549
2,3,5-trichloro-6-[2-(2-methylpropylamino)-2-oxoethoxy]benzoate (PubChem CID 9114549) has the molecular formula C13H13Cl3NO4- and a molecular weight of 353.61 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[2-(2-methylpropylamino)-2-oxoethoxy]benzoate.
| Compound Name | 2,3,5-trichloro-6-[2-(2-methylpropylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 9114549 |
| Molecular Formula | C13H13Cl3NO4- |
| Molecular Weight | 353.61 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2,3,5-trichloro-6-[2-(2-methylpropylamino)-2-oxoethoxy]benzoate |
| SMILES | CC(C)CNC(=O)COc1c(Cl)cc(Cl)c(Cl)c1C(=O)[O-] |
| InChI | InChI=1S/C13H14Cl3NO4/c1-6(2)4-17-9(18)5-21-12-8(15)3-7(14)11(16)10(12)13(19)20/h3,6H,4-5H2,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | APZNNLUUJHROPH-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|