C25H38N4O — CID 91146127
(4-cyclobutylpiperazin-1-yl)-[7-(3-pyridin-4-ylpropyl)-7-azaspiro[3.5]nonan-2-yl]methanone (PubChem CID 91146127) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is (4-cyclobutylpiperazin-1-yl)-[7-(3-pyridin-4-ylpropyl)-7-azaspiro[3.5]nonan-2-yl]methanone.
| Compound Name | (4-cyclobutylpiperazin-1-yl)-[7-(3-pyridin-4-ylpropyl)-7-azaspiro[3.5]nonan-2-yl]methanone |
|---|---|
| PubChem CID | 91146127 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | (4-cyclobutylpiperazin-1-yl)-[7-(3-pyridin-4-ylpropyl)-7-azaspiro[3.5]nonan-2-yl]methanone |
| SMILES | O=C(C1CC2(CCN(CCCc3ccncc3)CC2)C1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C25H38N4O/c30-24(29-17-15-28(16-18-29)23-4-1-5-23)22-19-25(20-22)8-13-27(14-9-25)12-2-3-21-6-10-26-11-7-21/h6-7,10-11,22-23H,1-5,8-9,12-20H2 |
| InChIKey | AOWGBGORSJOEDQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |