C32H39N3O4 — CID 91146971
N-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]-1,2,3,4-tetrahydroquinoline-7-carboxamide (PubChem CID 91146971) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]-1,2,3,4-tetrahydroquinoline-7-carboxamide.
| Compound Name | N-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]-1,2,3,4-tetrahydroquinoline-7-carboxamide |
|---|---|
| PubChem CID | 91146971 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]-1,2,3,4-tetrahydroquinoline-7-carboxamide |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCNCC2NC(=O)c2ccc3c(c2)NCCC3)cc1 |
| InChI | InChI=1S/C32H39N3O4/c1-37-31-8-3-2-6-26(31)22-38-18-5-19-39-27-13-11-23(12-14-27)28-15-17-33-21-30(28)35-32(36)25-10-9-24-7-4-16-34-29(24)20-25/h2-3,6,8-14,20,28,30,33-34H,4-5,7,15-19,21-22H2,1H3,(H,35,36) |
| InChIKey | VFMAUBBJPKBXNZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|