C35H46N2O7 — CID 91419292
4-[hydroxy-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl]-2-(3-methoxypropoxymethyl)benzamide (PubChem CID 91419292) has the molecular formula C35H46N2O7 and a molecular weight of 606.76 g/mol. Its IUPAC name is 4-[hydroxy-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl]-2-(3-methoxypropoxymethyl)benzamide.
| Compound Name | 4-[hydroxy-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl]-2-(3-methoxypropoxymethyl)benzamide |
|---|---|
| PubChem CID | 91419292 |
| Molecular Formula | C35H46N2O7 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | 4-[hydroxy-[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]methyl]-2-(3-methoxypropoxymethyl)benzamide |
| SMILES | COCCCOCc1cc(C(O)C2CNCCC2c2ccc(OCCCOCc3ccccc3OC)cc2)ccc1C(N)=O |
| InChI | InChI=1S/C35H46N2O7/c1-40-17-5-18-43-24-28-21-26(11-14-31(28)35(36)39)34(38)32-22-37-16-15-30(32)25-9-12-29(13-10-25)44-20-6-19-42-23-27-7-3-4-8-33(27)41-2/h3-4,7-14,21,30,32,34,37-38H,5-6,15-20,22-24H2,1-2H3,(H2,36,39) |
| InChIKey | UQURVGCIMQJJAS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|