C34H44N2O6 — CID 91333195
3-methoxy-N-[3-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]phenyl]butanamide (PubChem CID 91333195) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is 3-methoxy-N-[3-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]phenyl]butanamide.
| Compound Name | 3-methoxy-N-[3-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]phenyl]butanamide |
|---|---|
| PubChem CID | 91333195 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 3-methoxy-N-[3-[[4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]phenyl]butanamide |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCNCC2OCc2cccc(NC(=O)CC(C)OC)c2)cc1 |
| InChI | InChI=1S/C34H44N2O6/c1-25(38-2)20-34(37)36-29-10-6-8-26(21-29)23-42-33-22-35-17-16-31(33)27-12-14-30(15-13-27)41-19-7-18-40-24-28-9-4-5-11-32(28)39-3/h4-6,8-15,21,25,31,33,35H,7,16-20,22-24H2,1-3H3,(H,36,37) |
| InChIKey | HJMZULSJBIXSTB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|