C21H27N4O2+ — CID 9114712
3-(benzimidazol-1-yl)propyl-[(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]azanium (PubChem CID 9114712) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)propyl-[(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]azanium.
| Compound Name | 3-(benzimidazol-1-yl)propyl-[(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 9114712 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 3-(benzimidazol-1-yl)propyl-[(2S)-4-(2-methoxyanilino)-4-oxobutan-2-yl]azanium |
| SMILES | COc1ccccc1NC(=O)C[C@H](C)[NH2+]CCCn1cnc2ccccc21 |
| InChI | InChI=1S/C21H26N4O2/c1-16(14-21(26)24-18-9-4-6-11-20(18)27-2)22-12-7-13-25-15-23-17-8-3-5-10-19(17)25/h3-6,8-11,15-16,22H,7,12-14H2,1-2H3,(H,24,26)/p+1/t16-/m0/s1 |
| InChIKey | PALMEPOMBAEXSG-INIZCTEOSA-O |
| XLogP | 2.42 |
| TPSA | 72.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|