C20H26FN3O2 — CID 9114901
(2R)-N-(4-fluorophenyl)-2-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]propanamide (PubChem CID 9114901) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is (2R)-N-(4-fluorophenyl)-2-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]propanamide.
| Compound Name | (2R)-N-(4-fluorophenyl)-2-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]propanamide |
|---|---|
| PubChem CID | 9114901 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (2R)-N-(4-fluorophenyl)-2-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]propanamide |
| SMILES | C[C@@H](NC[C@@H](c1ccco1)N1CCCCC1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O2/c1-15(20(25)23-17-9-7-16(21)8-10-17)22-14-18(19-6-5-13-26-19)24-11-3-2-4-12-24/h5-10,13,15,18,22H,2-4,11-12,14H2,1H3,(H,23,25)/t15-,18+/m1/s1 |
| InChIKey | RTUNJAOKVMRPCL-QAPCUYQASA-N |
| XLogP | 3.56 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |