C16H20ClNO3 — CID 91150342
methyl 2-(4-chloro-2-methylphenyl)imino-5,5-dimethyl-4-oxohexanoate (PubChem CID 91150342) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-methylphenyl)imino-5,5-dimethyl-4-oxohexanoate.
| Compound Name | methyl 2-(4-chloro-2-methylphenyl)imino-5,5-dimethyl-4-oxohexanoate |
|---|---|
| PubChem CID | 91150342 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 2-(4-chloro-2-methylphenyl)imino-5,5-dimethyl-4-oxohexanoate |
| SMILES | COC(=O)/C(CC(=O)C(C)(C)C)=N\c1ccc(Cl)cc1C |
| InChI | InChI=1S/C16H20ClNO3/c1-10-8-11(17)6-7-12(10)18-13(15(20)21-5)9-14(19)16(2,3)4/h6-8H,9H2,1-5H3/b18-13- |
| InChIKey | AMANBWGUHDICEO-AQTBWJFISA-N |
| XLogP | 3.90 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|