C22H12N2O4 — CID 91152992
acridino[5,6-b]quinoline-3,10-dicarboxylic acid (PubChem CID 91152992) has the molecular formula C22H12N2O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is acridino[5,6-b]quinoline-3,10-dicarboxylic acid.
| Compound Name | acridino[5,6-b]quinoline-3,10-dicarboxylic acid |
|---|---|
| PubChem CID | 91152992 |
| Molecular Formula | C22H12N2O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | acridino[5,6-b]quinoline-3,10-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2nc3c(ccc4cc5cc(C(=O)O)ccc5nc43)cc2c1 |
| InChI | InChI=1S/C22H12N2O4/c25-21(26)13-3-5-17-15(9-13)7-11-1-2-12-8-16-10-14(22(27)28)4-6-18(16)24-20(12)19(11)23-17/h1-10H,(H,25,26)(H,27,28) |
| InChIKey | LBHLCOVWICUBOX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|