About benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate
benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 91154312) has the molecular formula C25H21N5O3
and a molecular weight of 439.48 g/mol. Its IUPAC name is benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| PubChem CID | 91154312 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=Nc2nnnn2C(c2cccc(Oc3ccccc3)c2)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H21N5O3/c1-17-22(24(31)32-16-18-9-4-2-5-10-18)23(30-25(26-17)27-28-29-30)19-11-8-14-21(15-19)33-20-12-6-3-7-13-20/h2-15,22-23H,16H2,1H3 |
| InChIKey | TZIHBOLCXWEADM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The IUPAC name of benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (CID 91154312) is benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
What is the SMILES notation for benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The canonical SMILES for benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate is CC1=Nc2nnnn2C(c2cccc(Oc3ccccc3)c2)C1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
The InChIKey is TZIHBOLCXWEADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5O3/c1-17-22(24(31)32-16-18-9-4-2-5-10-18)23(30-25(26-17)27-28-29-30)19-11-8-14-21(15-19)33-20-12-6-3-7-13-20/h2-15,22-23H,16H2,1H3.
What are the key properties of benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate?
benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate has a molecular weight of 439.48 g/mol, XLogP of 4.52, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-methyl-7-(3-phenoxyphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate is sourced from PubChem (CID 91154312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).