C16H16F5NO2 — CID 91156265
4,4-bis(fluoromethyl)-7-[4-(trifluoromethyl)phenoxy]hept-2-ynamide (PubChem CID 91156265) has the molecular formula C16H16F5NO2 and a molecular weight of 349.30 g/mol. Its IUPAC name is 4,4-bis(fluoromethyl)-7-[4-(trifluoromethyl)phenoxy]hept-2-ynamide.
| Compound Name | 4,4-bis(fluoromethyl)-7-[4-(trifluoromethyl)phenoxy]hept-2-ynamide |
|---|---|
| PubChem CID | 91156265 |
| Molecular Formula | C16H16F5NO2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4,4-bis(fluoromethyl)-7-[4-(trifluoromethyl)phenoxy]hept-2-ynamide |
| SMILES | NC(=O)C#CC(CF)(CF)CCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F5NO2/c17-10-15(11-18,8-6-14(22)23)7-1-9-24-13-4-2-12(3-5-13)16(19,20)21/h2-5H,1,7,9-11H2,(H2,22,23) |
| InChIKey | OBUPUFWNWIIUMX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|