C23H23N3O — CID 91158714
5-[2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridin-7-yl]oxyisoquinoline (PubChem CID 91158714) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 5-[2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridin-7-yl]oxyisoquinoline.
| Compound Name | 5-[2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridin-7-yl]oxyisoquinoline |
|---|---|
| PubChem CID | 91158714 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 5-[2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridin-7-yl]oxyisoquinoline |
| SMILES | CC(C)=CCn1c(C)c(C)c2ccnc(Oc3cccc4cnccc34)c21 |
| InChI | InChI=1S/C23H23N3O/c1-15(2)10-13-26-17(4)16(3)19-9-12-25-23(22(19)26)27-21-7-5-6-18-14-24-11-8-20(18)21/h5-12,14H,13H2,1-4H3 |
| InChIKey | AYJRCACDXDOCIQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|