C14H19ClN2 — CID 68813353
2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridine;hydrochloride (PubChem CID 68813353) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridine;hydrochloride.
| Compound Name | 2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 68813353 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2,3-dimethyl-1-(3-methylbut-2-enyl)pyrrolo[2,3-c]pyridine;hydrochloride |
| SMILES | CC(C)=CCn1c(C)c(C)c2ccncc21.Cl |
| InChI | InChI=1S/C14H18N2.ClH/c1-10(2)6-8-16-12(4)11(3)13-5-7-15-9-14(13)16;/h5-7,9H,8H2,1-4H3;1H |
| InChIKey | HRKGPLQGXYGYNX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|