C39H49N3 — CID 142955102
(3E,5E,8Z,9Z,12E,14Z,17Z)-17-[(Z)-3-(2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl)prop-1-enyl]-15-ethenyl-6-ethyl-8-ethylidene-N-methylicosa-1,3,5,9,12,14,17,19-octaen-3-amine (PubChem CID 142955102) has the molecular formula C39H49N3 and a molecular weight of 559.84 g/mol. Its IUPAC name is (3E,5E,8Z,9Z,12E,14Z,17Z)-17-[(Z)-3-(2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl)prop-1-enyl]-15-ethenyl-6-ethyl-8-ethylidene-N-methylicosa-1,3,5,9,12,14,17,19-octaen-3-amine.
| Compound Name | (3E,5E,8Z,9Z,12E,14Z,17Z)-17-[(Z)-3-(2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl)prop-1-enyl]-15-ethenyl-6-ethyl-8-ethylidene-N-methylicosa-1,3,5,9,12,14,17,19-octaen-3-amine |
|---|---|
| PubChem CID | 142955102 |
| Molecular Formula | C39H49N3 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.39 |
| IUPAC Name | (3E,5E,8Z,9Z,12E,14Z,17Z)-17-[(Z)-3-(2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl)prop-1-enyl]-15-ethenyl-6-ethyl-8-ethylidene-N-methylicosa-1,3,5,9,12,14,17,19-octaen-3-amine |
| SMILES | C=C/C=C(\C=C/Cn1c(C)c(C)c2ccncc21)C/C(C=C)=C/C=C/C/C=C\C(=C/C)C/C(=C/C=C(\C=C)NC)CC |
| InChI | InChI=1S/C39H49N3/c1-9-19-36(22-18-27-42-32(7)31(6)38-25-26-41-30-39(38)42)29-34(11-3)21-17-15-14-16-20-33(10-2)28-35(12-4)23-24-37(13-5)40-8/h9-11,13,15-26,30,40H,1,3,5,12,14,27-29H2,2,4,6-8H3/b17-15+,20-16-,22-18-,33-10+,34-21+,35-23+,36-19+,37-24+ |
| InChIKey | PEXPQKOHYGVATA-QLIYJHCNSA-N |
| XLogP | 10.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|