C15H15N5O3S2 — CID 9115876
N'-(4-cyanophenyl)sulfonyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide (PubChem CID 9115876) has the molecular formula C15H15N5O3S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N'-(4-cyanophenyl)sulfonyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide.
| Compound Name | N'-(4-cyanophenyl)sulfonyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 9115876 |
| Molecular Formula | C15H15N5O3S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N'-(4-cyanophenyl)sulfonyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetohydrazide |
| SMILES | Cc1cc(C)nc(SCC(=O)NNS(=O)(=O)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C15H15N5O3S2/c1-10-7-11(2)18-15(17-10)24-9-14(21)19-20-25(22,23)13-5-3-12(8-16)4-6-13/h3-7,20H,9H2,1-2H3,(H,19,21) |
| InChIKey | AYQHCULPAIPNDI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|