C26H42FNO2 — CID 91159035
N-[1-(5-tert-butyl-2-methylfuran-3-yl)ethyl]-3-ethyl-6-(2-fluoro-2-methylbutoxy)octa-3,5,7-trien-2-amine (PubChem CID 91159035) has the molecular formula C26H42FNO2 and a molecular weight of 419.63 g/mol. Its IUPAC name is N-[1-(5-tert-butyl-2-methylfuran-3-yl)ethyl]-3-ethyl-6-(2-fluoro-2-methylbutoxy)octa-3,5,7-trien-2-amine.
| Compound Name | N-[1-(5-tert-butyl-2-methylfuran-3-yl)ethyl]-3-ethyl-6-(2-fluoro-2-methylbutoxy)octa-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 91159035 |
| Molecular Formula | C26H42FNO2 |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.32 |
| IUPAC Name | N-[1-(5-tert-butyl-2-methylfuran-3-yl)ethyl]-3-ethyl-6-(2-fluoro-2-methylbutoxy)octa-3,5,7-trien-2-amine |
| SMILES | C=CC(=CC=C(CC)C(C)NC(C)c1cc(C(C)(C)C)oc1C)OCC(C)(F)CC |
| InChI | InChI=1S/C26H42FNO2/c1-11-21(14-15-22(12-2)29-17-26(10,27)13-3)18(4)28-19(5)23-16-24(25(7,8)9)30-20(23)6/h12,14-16,18-19,28H,2,11,13,17H2,1,3-10H3 |
| InChIKey | LHRJXRPILRFVJC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|