C8H18N4S2 — CID 91162325
1,3-diethyl-1-[methyl(methylcarbamothioyl)amino]thiourea (PubChem CID 91162325) has the molecular formula C8H18N4S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1,3-diethyl-1-[methyl(methylcarbamothioyl)amino]thiourea.
| Compound Name | 1,3-diethyl-1-[methyl(methylcarbamothioyl)amino]thiourea |
|---|---|
| PubChem CID | 91162325 |
| Molecular Formula | C8H18N4S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1,3-diethyl-1-[methyl(methylcarbamothioyl)amino]thiourea |
| SMILES | CCNC(=S)N(CC)N(C)C(=S)NC |
| InChI | InChI=1S/C8H18N4S2/c1-5-10-8(14)12(6-2)11(4)7(13)9-3/h5-6H2,1-4H3,(H,9,13)(H,10,14) |
| InChIKey | OWDNVJHJUDKBOM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|