C36H34Cl2Si — CID 91164417
(5,6-dichloro-2-ethyl-7-phenyl-1H-inden-1-yl)-(2-ethyl-7-phenyl-3H-inden-1-yl)-dimethylsilane (PubChem CID 91164417) has the molecular formula C36H34Cl2Si and a molecular weight of 565.66 g/mol. Its IUPAC name is (5,6-dichloro-2-ethyl-7-phenyl-1H-inden-1-yl)-(2-ethyl-7-phenyl-3H-inden-1-yl)-dimethylsilane.
| Compound Name | (5,6-dichloro-2-ethyl-7-phenyl-1H-inden-1-yl)-(2-ethyl-7-phenyl-3H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 91164417 |
| Molecular Formula | C36H34Cl2Si |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | (5,6-dichloro-2-ethyl-7-phenyl-1H-inden-1-yl)-(2-ethyl-7-phenyl-3H-inden-1-yl)-dimethylsilane |
| SMILES | CCC1=Cc2cc(Cl)c(Cl)c(-c3ccccc3)c2C1[Si](C)(C)C1=C(CC)Cc2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C36H34Cl2Si/c1-5-23-20-27-18-13-19-29(25-14-9-7-10-15-25)31(27)35(23)39(3,4)36-24(6-2)21-28-22-30(37)34(38)32(33(28)36)26-16-11-8-12-17-26/h7-19,21-22,36H,5-6,20H2,1-4H3 |
| InChIKey | VTTBELAEXHHSPX-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|