C52H52Si — CID 87558333
bis[7-(4-tert-butylphenyl)-2-phenyl-3H-inden-1-yl]-dimethylsilane (PubChem CID 87558333) has the molecular formula C52H52Si and a molecular weight of 705.07 g/mol. Its IUPAC name is bis[7-(4-tert-butylphenyl)-2-phenyl-3H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[7-(4-tert-butylphenyl)-2-phenyl-3H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 87558333 |
| Molecular Formula | C52H52Si |
| Molecular Weight | 705.07 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | bis[7-(4-tert-butylphenyl)-2-phenyl-3H-inden-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)c1ccc(-c2cccc3c2C([Si](C)(C)C2=C(c4ccccc4)Cc4cccc(-c5ccc(C(C)(C)C)cc5)c42)=C(c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C52H52Si/c1-51(2,3)41-29-25-37(26-30-41)43-23-15-21-39-33-45(35-17-11-9-12-18-35)49(47(39)43)53(7,8)50-46(36-19-13-10-14-20-36)34-40-22-16-24-44(48(40)50)38-27-31-42(32-28-38)52(4,5)6/h9-32H,33-34H2,1-8H3 |
| InChIKey | JJGZJELJABQMOR-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.07 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|