C39H34Si — CID 54094543
methyl-(2-methyl-7-phenyl-1H-inden-1-yl)-(2-methyl-7-phenyl-3H-inden-1-yl)-phenylsilane (PubChem CID 54094543) has the molecular formula C39H34Si and a molecular weight of 530.79 g/mol. Its IUPAC name is methyl-(2-methyl-7-phenyl-1H-inden-1-yl)-(2-methyl-7-phenyl-3H-inden-1-yl)-phenylsilane.
| Compound Name | methyl-(2-methyl-7-phenyl-1H-inden-1-yl)-(2-methyl-7-phenyl-3H-inden-1-yl)-phenylsilane |
|---|---|
| PubChem CID | 54094543 |
| Molecular Formula | C39H34Si |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | methyl-(2-methyl-7-phenyl-1H-inden-1-yl)-(2-methyl-7-phenyl-3H-inden-1-yl)-phenylsilane |
| SMILES | CC1=Cc2cccc(-c3ccccc3)c2C1[Si](C)(C1=C(C)Cc2cccc(-c3ccccc3)c21)c1ccccc1 |
| InChI | InChI=1S/C39H34Si/c1-27-25-31-19-13-23-34(29-15-7-4-8-16-29)36(31)38(27)40(3,33-21-11-6-12-22-33)39-28(2)26-32-20-14-24-35(37(32)39)30-17-9-5-10-18-30/h4-25,38H,26H2,1-3H3 |
| InChIKey | BFWGEGYAHFFDCK-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|