C14H25NO8 — CID 91165515
[(2R,3R)-3-[(2R,3R,4S,6R)-3-acetamido-6-ethyl-4,6-dihydroxyoxan-2-yl]-2,3-dihydroxypropyl] acetate (PubChem CID 91165515) has the molecular formula C14H25NO8 and a molecular weight of 335.35 g/mol. Its IUPAC name is [(2R,3R)-3-[(2R,3R,4S,6R)-3-acetamido-6-ethyl-4,6-dihydroxyoxan-2-yl]-2,3-dihydroxypropyl] acetate.
| Compound Name | [(2R,3R)-3-[(2R,3R,4S,6R)-3-acetamido-6-ethyl-4,6-dihydroxyoxan-2-yl]-2,3-dihydroxypropyl] acetate |
|---|---|
| PubChem CID | 91165515 |
| Molecular Formula | C14H25NO8 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(2R,3R)-3-[(2R,3R,4S,6R)-3-acetamido-6-ethyl-4,6-dihydroxyoxan-2-yl]-2,3-dihydroxypropyl] acetate |
| SMILES | CC[C@]1(O)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)COC(C)=O)O1 |
| InChI | InChI=1S/C14H25NO8/c1-4-14(21)5-9(18)11(15-7(2)16)13(23-14)12(20)10(19)6-22-8(3)17/h9-13,18-21H,4-6H2,1-3H3,(H,15,16)/t9-,10+,11+,12+,13+,14+/m0/s1 |
| InChIKey | IGIYYQZSJOHWGM-YHBOFVJASA-N |
| XLogP | -1.98 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |