About 2-methylpyrazolo[4,3-d]pyrimidin-7-amine
2-methylpyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 91165964) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is 2-methylpyrazolo[4,3-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-methylpyrazolo[4,3-d]pyrimidin-7-amine |
| PubChem CID | 91165964 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2-methylpyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | Cn1cc2ncnc(N)c2n1 |
| InChI | InChI=1S/C6H7N5/c1-11-2-4-5(10-11)6(7)9-3-8-4/h2-3H,1H3,(H2,7,8,9) |
| InChIKey | DIIZXWCIRGKDPX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpyrazolo[4,3-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrazolo[4,3-d]pyrimidin-7-amine?
The IUPAC name of 2-methylpyrazolo[4,3-d]pyrimidin-7-amine (CID 91165964) is 2-methylpyrazolo[4,3-d]pyrimidin-7-amine.
What is the SMILES notation for 2-methylpyrazolo[4,3-d]pyrimidin-7-amine?
The canonical SMILES for 2-methylpyrazolo[4,3-d]pyrimidin-7-amine is Cn1cc2ncnc(N)c2n1.
What is the InChIKey of 2-methylpyrazolo[4,3-d]pyrimidin-7-amine?
The InChIKey is DIIZXWCIRGKDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c1-11-2-4-5(10-11)6(7)9-3-8-4/h2-3H,1H3,(H2,7,8,9).
What are the key properties of 2-methylpyrazolo[4,3-d]pyrimidin-7-amine?
2-methylpyrazolo[4,3-d]pyrimidin-7-amine has a molecular weight of 149.16 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrazolo[4,3-d]pyrimidin-7-amine is sourced from PubChem (CID 91165964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).