C8H11N2O8+ — CID 91166436
bis(1,2-dicarboxyethyl)-iminoazanium (PubChem CID 91166436) has the molecular formula C8H11N2O8+ and a molecular weight of 263.18 g/mol. Its IUPAC name is bis(1,2-dicarboxyethyl)-iminoazanium.
| Compound Name | bis(1,2-dicarboxyethyl)-iminoazanium |
|---|---|
| PubChem CID | 91166436 |
| Molecular Formula | C8H11N2O8+ |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | bis(1,2-dicarboxyethyl)-iminoazanium |
| SMILES | [H]N=[N+](C(CC(=O)O)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10N2O8/c9-10(3(7(15)16)1-5(11)12)4(8(17)18)2-6(13)14/h3-4,9H,1-2H2,(H3-,11,12,13,14,15,16,17,18)/p+1 |
| InChIKey | FSELEXOQBSXRSM-UHFFFAOYSA-O |
| XLogP | -1.11 |
| TPSA | 176.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|