C10H17N — CID 91167971
7-ethyl-4,5-dimethyl-3,4-dihydro-2H-azepine (PubChem CID 91167971) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 7-ethyl-4,5-dimethyl-3,4-dihydro-2H-azepine.
| Compound Name | 7-ethyl-4,5-dimethyl-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 91167971 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 7-ethyl-4,5-dimethyl-3,4-dihydro-2H-azepine |
| SMILES | CCC1=NCCC(C)C(C)=C1 |
| InChI | InChI=1S/C10H17N/c1-4-10-7-9(3)8(2)5-6-11-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | UWBFNOVJKYVELC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |