C38H52BrF2O5S2+ — CID 91168972
[2-(6-bromohexoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium (PubChem CID 91168972) has the molecular formula C38H52BrF2O5S2+ and a molecular weight of 770.86 g/mol. Its IUPAC name is [2-(6-bromohexoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium.
| Compound Name | [2-(6-bromohexoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 91168972 |
| Molecular Formula | C38H52BrF2O5S2+ |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 769.24 |
| IUPAC Name | [2-(6-bromohexoxy)-1,1-difluoro-2-oxoethyl]sulfonyl-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxidanium |
| SMILES | CC(C)(C)c1ccc(S([OH+]S(=O)(=O)C(F)(F)C(=O)OCCCCCCBr)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H51BrF2O5S2/c1-35(2,3)28-14-20-31(21-15-28)47(32-22-16-29(17-23-32)36(4,5)6,33-24-18-30(19-25-33)37(7,8)9)46-48(43,44)38(40,41)34(42)45-27-13-11-10-12-26-39/h14-25H,10-13,26-27H2,1-9H3/p+1 |
| InChIKey | BFKIEMKNANZWGS-UHFFFAOYSA-O |
| XLogP | 11.29 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|