C14H10N2O5 — CID 91170787
methyl 3-(5-acetyloxy-3,4-dicyano-2-hydroxyphenyl)prop-2-enoate (PubChem CID 91170787) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is methyl 3-(5-acetyloxy-3,4-dicyano-2-hydroxyphenyl)prop-2-enoate.
| Compound Name | methyl 3-(5-acetyloxy-3,4-dicyano-2-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91170787 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl 3-(5-acetyloxy-3,4-dicyano-2-hydroxyphenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(OC(C)=O)c(C#N)c(C#N)c1O |
| InChI | InChI=1S/C14H10N2O5/c1-8(17)21-12-5-9(3-4-13(18)20-2)14(19)11(7-16)10(12)6-15/h3-5,19H,1-2H3 |
| InChIKey | DXMUYHSCACZUEN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|