C22H30N2O9 — CID 91172044
methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(4,4,4-trihydroxybut-2-ynoxy)benzoyl]amino]butanoate (PubChem CID 91172044) has the molecular formula C22H30N2O9 and a molecular weight of 466.49 g/mol. Its IUPAC name is methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(4,4,4-trihydroxybut-2-ynoxy)benzoyl]amino]butanoate.
| Compound Name | methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(4,4,4-trihydroxybut-2-ynoxy)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 91172044 |
| Molecular Formula | C22H30N2O9 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(4,4,4-trihydroxybut-2-ynoxy)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(OCC#CC(O)(O)O)cc1)C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O9/c1-20(2,3)33-19(27)24-21(4,5)16(18(26)31-6)23-17(25)14-8-10-15(11-9-14)32-13-7-12-22(28,29)30/h8-11,16,28-30H,13H2,1-6H3,(H,23,25)(H,24,27) |
| InChIKey | HSFGXWBDMJZVJD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|