C26H35NO7 — CID 157143850
5-O-tert-butyl 1-O-methyl (2S)-2-[[4-[(E)-7-hydroxyhept-2-en-4-ynoxy]benzoyl]amino]-3,3-dimethylpentanedioate (PubChem CID 157143850) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl (2S)-2-[[4-[(E)-7-hydroxyhept-2-en-4-ynoxy]benzoyl]amino]-3,3-dimethylpentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-methyl (2S)-2-[[4-[(E)-7-hydroxyhept-2-en-4-ynoxy]benzoyl]amino]-3,3-dimethylpentanedioate |
|---|---|
| PubChem CID | 157143850 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl (2S)-2-[[4-[(E)-7-hydroxyhept-2-en-4-ynoxy]benzoyl]amino]-3,3-dimethylpentanedioate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(OC/C=C/C#CCCO)cc1)C(C)(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35NO7/c1-25(2,3)34-21(29)18-26(4,5)22(24(31)32-6)27-23(30)19-12-14-20(15-13-19)33-17-11-9-7-8-10-16-28/h9,11-15,22,28H,10,16-18H2,1-6H3,(H,27,30)/b11-9+/t22-/m1/s1 |
| InChIKey | IXQYKMWVCOMSGF-XBFAEUMISA-N |
| XLogP | 3.04 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|