C21H30IN3O4 — CID 143958992
N-[4-amino-1-[[(1S)-1-hydroxyethyl]amino]-4-methyl-2-oxopentan-3-yl]-4-(4-iodo-4-methylpent-2-ynoxy)benzamide (PubChem CID 143958992) has the molecular formula C21H30IN3O4 and a molecular weight of 515.39 g/mol. Its IUPAC name is N-[4-amino-1-[[(1S)-1-hydroxyethyl]amino]-4-methyl-2-oxopentan-3-yl]-4-(4-iodo-4-methylpent-2-ynoxy)benzamide.
| Compound Name | N-[4-amino-1-[[(1S)-1-hydroxyethyl]amino]-4-methyl-2-oxopentan-3-yl]-4-(4-iodo-4-methylpent-2-ynoxy)benzamide |
|---|---|
| PubChem CID | 143958992 |
| Molecular Formula | C21H30IN3O4 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-[4-amino-1-[[(1S)-1-hydroxyethyl]amino]-4-methyl-2-oxopentan-3-yl]-4-(4-iodo-4-methylpent-2-ynoxy)benzamide |
| SMILES | C[C@H](O)NCC(=O)C(NC(=O)c1ccc(OCC#CC(C)(C)I)cc1)C(C)(C)N |
| InChI | InChI=1S/C21H30IN3O4/c1-14(26)24-13-17(27)18(21(4,5)23)25-19(28)15-7-9-16(10-8-15)29-12-6-11-20(2,3)22/h7-10,14,18,24,26H,12-13,23H2,1-5H3,(H,25,28)/t14-,18?/m0/s1 |
| InChIKey | GIJCJALSVLBMNU-PIVQAISJSA-N |
| XLogP | 1.62 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|