C9H14N2O — CID 91173291
3-(2,3-dihydropyridin-2-yl)morpholine (PubChem CID 91173291) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-(2,3-dihydropyridin-2-yl)morpholine.
| Compound Name | 3-(2,3-dihydropyridin-2-yl)morpholine |
|---|---|
| PubChem CID | 91173291 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-(2,3-dihydropyridin-2-yl)morpholine |
| SMILES | C1=CCC(C2COCCN2)N=C1 |
| InChI | InChI=1S/C9H14N2O/c1-2-4-10-8(3-1)9-7-12-6-5-11-9/h1-2,4,8-9,11H,3,5-7H2 |
| InChIKey | AJRSIDXUBAICGM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |