C14H21NO5S2 — CID 91175839
[(4-methylphenyl)sulfonyl-piperidin-2-ylmethyl] methanesulfonate (PubChem CID 91175839) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(4-methylphenyl)sulfonyl-piperidin-2-ylmethyl] methanesulfonate.
| Compound Name | [(4-methylphenyl)sulfonyl-piperidin-2-ylmethyl] methanesulfonate |
|---|---|
| PubChem CID | 91175839 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [(4-methylphenyl)sulfonyl-piperidin-2-ylmethyl] methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)C(OS(C)(=O)=O)C2CCCCN2)cc1 |
| InChI | InChI=1S/C14H21NO5S2/c1-11-6-8-12(9-7-11)22(18,19)14(20-21(2,16)17)13-5-3-4-10-15-13/h6-9,13-15H,3-5,10H2,1-2H3 |
| InChIKey | KLKGTMMOXCIRGZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|