C17H24FNO4S2 — CID 174520336
4-fluoro-4-[2-[1-(4-methylsulfonylphenyl)prop-2-enylsulfonyl]ethyl]piperidine (PubChem CID 174520336) has the molecular formula C17H24FNO4S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is 4-fluoro-4-[2-[1-(4-methylsulfonylphenyl)prop-2-enylsulfonyl]ethyl]piperidine.
| Compound Name | 4-fluoro-4-[2-[1-(4-methylsulfonylphenyl)prop-2-enylsulfonyl]ethyl]piperidine |
|---|---|
| PubChem CID | 174520336 |
| Molecular Formula | C17H24FNO4S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-fluoro-4-[2-[1-(4-methylsulfonylphenyl)prop-2-enylsulfonyl]ethyl]piperidine |
| SMILES | C=CC(c1ccc(S(C)(=O)=O)cc1)S(=O)(=O)CCC1(F)CCNCC1 |
| InChI | InChI=1S/C17H24FNO4S2/c1-3-16(14-4-6-15(7-5-14)24(2,20)21)25(22,23)13-10-17(18)8-11-19-12-9-17/h3-7,16,19H,1,8-13H2,2H3 |
| InChIKey | FVIHZOFQHNJRCE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|