About 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole
4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole (PubChem CID 91176392) has the molecular formula C17H12Cl4N2
and a molecular weight of 386.11 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole |
| PubChem CID | 91176392 |
| Molecular Formula | C17H12Cl4N2 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole |
| SMILES | Cc1[nH]c(Cc2cc(Cl)cc(Cl)c2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl4N2/c1-9-17(14-3-2-11(18)8-15(14)21)23-16(22-9)6-10-4-12(19)7-13(20)5-10/h2-5,7-8H,6H2,1H3,(H,22,23) |
| InChIKey | PMMLGBIKTFXXLX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole?
The IUPAC name of 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole (CID 91176392) is 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole?
The canonical SMILES for 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole is Cc1[nH]c(Cc2cc(Cl)cc(Cl)c2)nc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole?
The InChIKey is PMMLGBIKTFXXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl4N2/c1-9-17(14-3-2-11(18)8-15(14)21)23-16(22-9)6-10-4-12(19)7-13(20)5-10/h2-5,7-8H,6H2,1H3,(H,22,23).
What are the key properties of 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole?
4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole has a molecular weight of 386.11 g/mol, XLogP of 6.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-5-methyl-1H-imidazole is sourced from PubChem (CID 91176392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).