C38H36N4 — CID 91177110
4,20-bis(2,4,6-trimethylphenyl)-21,23-dihydro-1H-porphyrin (PubChem CID 91177110) has the molecular formula C38H36N4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 4,20-bis(2,4,6-trimethylphenyl)-21,23-dihydro-1H-porphyrin.
| Compound Name | 4,20-bis(2,4,6-trimethylphenyl)-21,23-dihydro-1H-porphyrin |
|---|---|
| PubChem CID | 91177110 |
| Molecular Formula | C38H36N4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 4,20-bis(2,4,6-trimethylphenyl)-21,23-dihydro-1H-porphyrin |
| SMILES | Cc1cc(C)c(C2=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC4(c5c(C)cc(C)cc5C)C=CC2N4)C=C3)c(C)c1 |
| InChI | InChI=1S/C38H36N4/c1-22-15-24(3)35(25(4)16-22)36-33-12-11-31(41-33)20-29-8-7-28(39-29)19-30-9-10-32(40-30)21-38(14-13-34(36)42-38)37-26(5)17-23(2)18-27(37)6/h7-21,34,39,42H,1-6H3 |
| InChIKey | MDDSKOROUWILBA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|