C50H60F6N4 — CID 152744726
1,2,3,4,5,6,7,8-octaethyl-9,11-bis[4-(trifluoromethyl)phenyl]-10,21,22,24-tetrahydro-5H-porphyrin (PubChem CID 152744726) has the molecular formula C50H60F6N4 and a molecular weight of 831.05 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octaethyl-9,11-bis[4-(trifluoromethyl)phenyl]-10,21,22,24-tetrahydro-5H-porphyrin.
| Compound Name | 1,2,3,4,5,6,7,8-octaethyl-9,11-bis[4-(trifluoromethyl)phenyl]-10,21,22,24-tetrahydro-5H-porphyrin |
|---|---|
| PubChem CID | 152744726 |
| Molecular Formula | C50H60F6N4 |
| Molecular Weight | 831.05 g/mol |
| Exact Mass | 830.47 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octaethyl-9,11-bis[4-(trifluoromethyl)phenyl]-10,21,22,24-tetrahydro-5H-porphyrin |
| SMILES | CCC1=C(CC)C2(CC)NC1(CC)C=c1ccc([nH]1)=CC1=NC(c3ccc(C(F)(F)F)cc3)(C=C1)CC1(c3ccc(C(F)(F)F)cc3)NC(CC)(C(CC)=C1CC)C2CC |
| InChI | InChI=1S/C50H60F6N4/c1-9-39-40(10-2)46(15-7)43(13-5)47(16-8)41(11-3)42(12-4)48(60-47,33-19-23-35(24-20-33)50(54,55)56)31-45(32-17-21-34(22-18-32)49(51,52)53)28-27-37(58-45)29-36-25-26-38(57-36)30-44(39,14-6)59-46/h17-30,43,57,59-60H,9-16,31H2,1-8H3 |
| InChIKey | VEBYNPJRGSDYCG-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.05 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|