C32H24N4 — CID 91068055
4,20-diphenyl-21,23-dihydro-1H-porphyrin (PubChem CID 91068055) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4,20-diphenyl-21,23-dihydro-1H-porphyrin.
| Compound Name | 4,20-diphenyl-21,23-dihydro-1H-porphyrin |
|---|---|
| PubChem CID | 91068055 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4,20-diphenyl-21,23-dihydro-1H-porphyrin |
| SMILES | C1=CC2=NC1=CC1(c3ccccc3)C=CC(N1)C(c1ccccc1)=C1C=CC(=N1)C=c1ccc([nH]1)=C2 |
| InChI | InChI=1S/C32H24N4/c1-3-7-22(8-4-1)31-29-16-15-27(35-29)20-25-12-11-24(33-25)19-26-13-14-28(34-26)21-32(18-17-30(31)36-32)23-9-5-2-6-10-23/h1-21,30,33,36H |
| InChIKey | KYJLDNQBPAVGQD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|