C32H24N4 — CID 138374123
(5Z,10Z,14Z,19Z)-1,3-diphenyl-21,23-dihydro-2H-porphyrin (PubChem CID 138374123) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is (5Z,10Z,14Z,19Z)-1,3-diphenyl-21,23-dihydro-2H-porphyrin.
| Compound Name | (5Z,10Z,14Z,19Z)-1,3-diphenyl-21,23-dihydro-2H-porphyrin |
|---|---|
| PubChem CID | 138374123 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (5Z,10Z,14Z,19Z)-1,3-diphenyl-21,23-dihydro-2H-porphyrin |
| SMILES | C1=C/C2=C/C3=C(c4ccccc4)CC(c4ccccc4)(/C=C4/C=CC(=N4)/C=c4/cc/c([nH]4)=C/C1=N2)N3 |
| InChI | InChI=1S/C32H24N4/c1-3-7-22(8-4-1)30-21-32(23-9-5-2-6-10-23)20-29-16-15-27(35-29)18-25-12-11-24(33-25)17-26-13-14-28(34-26)19-31(30)36-32/h1-20,33,36H,21H2/b24-17-,25-18-,28-19-,29-20- |
| InChIKey | QICNLFUOYDNMCW-CJQPGPEJSA-N |
| XLogP | 4.68 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |