C18H18N2 — CID 12644474
4,6-dimethyl-2,2-diphenyl-1H-pyrimidine (PubChem CID 12644474) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4,6-dimethyl-2,2-diphenyl-1H-pyrimidine.
| Compound Name | 4,6-dimethyl-2,2-diphenyl-1H-pyrimidine |
|---|---|
| PubChem CID | 12644474 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4,6-dimethyl-2,2-diphenyl-1H-pyrimidine |
| SMILES | CC1=CC(C)=NC(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C18H18N2/c1-14-13-15(2)20-18(19-14,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13,19H,1-2H3 |
| InChIKey | RDTPEGHSUOVAGK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |