C19H18N2S — CID 3004569
3,6-dimethyl-2,5-diphenyl-1,6-dihydro-1,4-diazepine-7-thione (PubChem CID 3004569) has the molecular formula C19H18N2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3,6-dimethyl-2,5-diphenyl-1,6-dihydro-1,4-diazepine-7-thione.
| Compound Name | 3,6-dimethyl-2,5-diphenyl-1,6-dihydro-1,4-diazepine-7-thione |
|---|---|
| PubChem CID | 3004569 |
| Molecular Formula | C19H18N2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3,6-dimethyl-2,5-diphenyl-1,6-dihydro-1,4-diazepine-7-thione |
| SMILES | CC1=C(c2ccccc2)NC(=S)C(C)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C19H18N2S/c1-13-17(15-9-5-3-6-10-15)20-14(2)18(21-19(13)22)16-11-7-4-8-12-16/h3-13H,1-2H3,(H,21,22) |
| InChIKey | KPNGPCJADYPWJW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|