C21H22N2S — CID 3004570
3,6-dimethyl-2,5-bis(4-methylphenyl)-1,6-dihydro-1,4-diazepine-7-thione (PubChem CID 3004570) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 3,6-dimethyl-2,5-bis(4-methylphenyl)-1,6-dihydro-1,4-diazepine-7-thione.
| Compound Name | 3,6-dimethyl-2,5-bis(4-methylphenyl)-1,6-dihydro-1,4-diazepine-7-thione |
|---|---|
| PubChem CID | 3004570 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3,6-dimethyl-2,5-bis(4-methylphenyl)-1,6-dihydro-1,4-diazepine-7-thione |
| SMILES | CC1=C(c2ccc(C)cc2)NC(=S)C(C)C(c2ccc(C)cc2)=N1 |
| InChI | InChI=1S/C21H22N2S/c1-13-5-9-17(10-6-13)19-15(3)21(24)23-20(16(4)22-19)18-11-7-14(2)8-12-18/h5-12,15H,1-4H3,(H,23,24) |
| InChIKey | DPBJTXPZRKQNTD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|