C27H22N4 — CID 141497519
(5Z,10Z,14Z,19Z)-1-(4-methylphenyl)-21,23-dihydro-2H-porphyrin (PubChem CID 141497519) has the molecular formula C27H22N4 and a molecular weight of 402.50 g/mol. Its IUPAC name is (5Z,10Z,14Z,19Z)-1-(4-methylphenyl)-21,23-dihydro-2H-porphyrin.
| Compound Name | (5Z,10Z,14Z,19Z)-1-(4-methylphenyl)-21,23-dihydro-2H-porphyrin |
|---|---|
| PubChem CID | 141497519 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (5Z,10Z,14Z,19Z)-1-(4-methylphenyl)-21,23-dihydro-2H-porphyrin |
| SMILES | Cc1ccc(C23/C=C4/C=CC(=N4)/C=c4/cc/c([nH]4)=C/C4=N/C(=C\C(=CC2)N3)C=C4)cc1 |
| InChI | InChI=1S/C27H22N4/c1-18-2-4-19(5-3-18)27-13-12-25(31-27)16-24-9-8-21(29-24)14-20-6-7-22(28-20)15-23-10-11-26(17-27)30-23/h2-12,14-17,28,31H,13H2,1H3/b20-14-,22-15-,24-16-,26-17- |
| InChIKey | NQKQEOBDZNQKJA-ATDWWFRUSA-N |
| XLogP | 3.46 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |