C32H39N3O3 — CID 91178390
5-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-(3,4-dimethoxyphenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 91178390) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 5-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-(3,4-dimethoxyphenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-(3,4-dimethoxyphenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91178390 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 5-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-(3,4-dimethoxyphenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | COc1ccc(C2=CC(CCCCN3CCN(C(c4ccccc4)c4ccccc4)CC3)ON2)cc1OC |
| InChI | InChI=1S/C32H39N3O3/c1-36-30-17-16-27(23-31(30)37-2)29-24-28(38-33-29)15-9-10-18-34-19-21-35(22-20-34)32(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-8,11-14,16-17,23-24,28,32-33H,9-10,15,18-22H2,1-2H3 |
| InChIKey | AXTUWQFWPGMCSO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|