C15H14N4O4 — CID 91179194
(1-carbamoylcyclobutyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate (PubChem CID 91179194) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is (1-carbamoylcyclobutyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate.
| Compound Name | (1-carbamoylcyclobutyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 91179194 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (1-carbamoylcyclobutyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate |
| SMILES | NC(=O)C1(OC(=O)c2cc(-c3ccncc3)n[nH]c2=O)CCC1 |
| InChI | InChI=1S/C15H14N4O4/c16-14(22)15(4-1-5-15)23-13(21)10-8-11(18-19-12(10)20)9-2-6-17-7-3-9/h2-3,6-8H,1,4-5H2,(H2,16,22)(H,19,20) |
| InChIKey | BSUHPBIVNZCABW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |